C10H7Cl3S2 — CID 107965730
2,5-dichloro-3-(1-chloro-2-thiophen-3-ylethyl)thiophene (PubChem CID 107965730) has the molecular formula C10H7Cl3S2 and a molecular weight of 297.66 g/mol. Its IUPAC name is 2,5-dichloro-3-(1-chloro-2-thiophen-3-ylethyl)thiophene.
| Compound Name | 2,5-dichloro-3-(1-chloro-2-thiophen-3-ylethyl)thiophene |
|---|---|
| PubChem CID | 107965730 |
| Molecular Formula | C10H7Cl3S2 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 295.91 |
| IUPAC Name | 2,5-dichloro-3-(1-chloro-2-thiophen-3-ylethyl)thiophene |
| SMILES | Clc1cc(C(Cl)Cc2ccsc2)c(Cl)s1 |
| InChI | InChI=1S/C10H7Cl3S2/c11-8(3-6-1-2-14-5-6)7-4-9(12)15-10(7)13/h1-2,4-5,8H,3H2 |
| InChIKey | OBTPYISOSYGILS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|