C9H10O3 — CID 10797132
(1R,2S,5R,6R,7S)-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 10797132) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1R,2S,5R,6R,7S)-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5R,6R,7S)-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 10797132 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (1R,2S,5R,6R,7S)-5-hydroxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1O[C@@H](O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C9H10O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-8,10H,3H2/t4-,5+,6-,7+,8-/m1/s1 |
| InChIKey | QJQKWWRFMPGUIQ-RZUNNTJFSA-N |
| XLogP | 0.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|