C10H14O2 — CID 10797243
4-[(2R,3R)-2,4,4,4-tetradeuterio-3-hydroxybutyl]phenol (PubChem CID 10797243) has the molecular formula C10H14O2 and a molecular weight of 170.24 g/mol. Its IUPAC name is 4-[(2R,3R)-2,4,4,4-tetradeuterio-3-hydroxybutyl]phenol.
| Compound Name | 4-[(2R,3R)-2,4,4,4-tetradeuterio-3-hydroxybutyl]phenol |
|---|---|
| PubChem CID | 10797243 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 4-[(2R,3R)-2,4,4,4-tetradeuterio-3-hydroxybutyl]phenol |
| SMILES | [2H][C@H](Cc1ccc(O)cc1)[C@H](O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H14O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-8,11-12H,2-3H2,1H3/t8-/m1/s1/i1D3,2D/t2-,8- |
| InChIKey | SFUCGABQOMYVJW-AGUJWVIXSA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |