C9H13NO — CID 169441539
4-(2-amino-1,1,2,3,3,3-hexadeuteriopropyl)phenol (PubChem CID 169441539) has the molecular formula C9H13NO and a molecular weight of 157.25 g/mol. Its IUPAC name is 4-(2-amino-1,1,2,3,3,3-hexadeuteriopropyl)phenol.
| Compound Name | 4-(2-amino-1,1,2,3,3,3-hexadeuteriopropyl)phenol |
|---|---|
| PubChem CID | 169441539 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 157.25 g/mol |
| Exact Mass | 157.14 |
| IUPAC Name | 4-(2-amino-1,1,2,3,3,3-hexadeuteriopropyl)phenol |
| SMILES | [2H]C([2H])([2H])C([2H])(N)C([2H])([2H])c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7,11H,6,10H2,1H3/i1D3,6D2,7D |
| InChIKey | GIKNHHRFLCDOEU-UUASTNDZSA-N |
| XLogP | 1.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |