C8H13NO3 — CID 10797262
(1R,2S,8S,8aS)-1,2,3,5,8,8a-hexahydroindolizine-1,2,8-triol (PubChem CID 10797262) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (1R,2S,8S,8aS)-1,2,3,5,8,8a-hexahydroindolizine-1,2,8-triol.
| Compound Name | (1R,2S,8S,8aS)-1,2,3,5,8,8a-hexahydroindolizine-1,2,8-triol |
|---|---|
| PubChem CID | 10797262 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (1R,2S,8S,8aS)-1,2,3,5,8,8a-hexahydroindolizine-1,2,8-triol |
| SMILES | O[C@@H]1[C@@H]2[C@@H](O)C=CCN2C[C@@H]1O |
| InChI | InChI=1S/C8H13NO3/c10-5-2-1-3-9-4-6(11)8(12)7(5)9/h1-2,5-8,10-12H,3-4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | PFSRZTHZLUQLLG-XAMCCFCMSA-N |
| XLogP | -1.68 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|