C11H18O2 — CID 10797518
(3R,4R)-4-methyl-4-prop-2-enoxyhepta-1,6-dien-3-ol (PubChem CID 10797518) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3R,4R)-4-methyl-4-prop-2-enoxyhepta-1,6-dien-3-ol.
| Compound Name | (3R,4R)-4-methyl-4-prop-2-enoxyhepta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 10797518 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3R,4R)-4-methyl-4-prop-2-enoxyhepta-1,6-dien-3-ol |
| SMILES | C=CCO[C@](C)(CC=C)[C@H](O)C=C |
| InChI | InChI=1S/C11H18O2/c1-5-8-11(4,10(12)7-3)13-9-6-2/h5-7,10,12H,1-3,8-9H2,4H3/t10-,11-/m1/s1 |
| InChIKey | KTKLBCGHCDDICF-GHMZBOCLSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|