C12H20O2 — CID 102376969
(2S)-1-methoxy-3,5-dimethylnona-3,4,8-trien-2-ol (PubChem CID 102376969) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2S)-1-methoxy-3,5-dimethylnona-3,4,8-trien-2-ol.
| Compound Name | (2S)-1-methoxy-3,5-dimethylnona-3,4,8-trien-2-ol |
|---|---|
| PubChem CID | 102376969 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2S)-1-methoxy-3,5-dimethylnona-3,4,8-trien-2-ol |
| SMILES | C=CCCC(C)=C=C(C)[C@H](O)COC |
| InChI | InChI=1S/C12H20O2/c1-5-6-7-10(2)8-11(3)12(13)9-14-4/h5,12-13H,1,6-7,9H2,2-4H3/t8?,12-/m1/s1 |
| InChIKey | GTEAFXZKJXHEDT-LESKNEHBSA-N |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|