C14H26O2 — CID 135038994
(4R)-4-[(2R)-3,3-dimethylhex-5-en-2-yl]oxyhex-1-en-3-ol (PubChem CID 135038994) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (4R)-4-[(2R)-3,3-dimethylhex-5-en-2-yl]oxyhex-1-en-3-ol.
| Compound Name | (4R)-4-[(2R)-3,3-dimethylhex-5-en-2-yl]oxyhex-1-en-3-ol |
|---|---|
| PubChem CID | 135038994 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (4R)-4-[(2R)-3,3-dimethylhex-5-en-2-yl]oxyhex-1-en-3-ol |
| SMILES | C=CCC(C)(C)[C@@H](C)O[C@H](CC)C(O)C=C |
| InChI | InChI=1S/C14H26O2/c1-7-10-14(5,6)11(4)16-13(9-3)12(15)8-2/h7-8,11-13,15H,1-2,9-10H2,3-6H3/t11-,12?,13-/m1/s1 |
| InChIKey | RXRWTPAKJJZROY-LKOMHFJYSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|