C15H22 — CID 10798169
1-[[(1S,2R)-2-butylcyclopropyl]methyl]-4-methylbenzene (PubChem CID 10798169) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-butylcyclopropyl]methyl]-4-methylbenzene.
| Compound Name | 1-[[(1S,2R)-2-butylcyclopropyl]methyl]-4-methylbenzene |
|---|---|
| PubChem CID | 10798169 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-[[(1S,2R)-2-butylcyclopropyl]methyl]-4-methylbenzene |
| SMILES | CCCC[C@@H]1C[C@H]1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C15H22/c1-3-4-5-14-11-15(14)10-13-8-6-12(2)7-9-13/h6-9,14-15H,3-5,10-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | WFSAMKJCVOKDAT-HUUCEWRRSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |