C13H17NO2 — CID 10798918
N-[4-hydroxy-2,6-dimethyl-3-(2-methylprop-2-enyl)phenyl]formamide (PubChem CID 10798918) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[4-hydroxy-2,6-dimethyl-3-(2-methylprop-2-enyl)phenyl]formamide.
| Compound Name | N-[4-hydroxy-2,6-dimethyl-3-(2-methylprop-2-enyl)phenyl]formamide |
|---|---|
| PubChem CID | 10798918 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[4-hydroxy-2,6-dimethyl-3-(2-methylprop-2-enyl)phenyl]formamide |
| SMILES | C=C(C)Cc1c(O)cc(C)c(NC=O)c1C |
| InChI | InChI=1S/C13H17NO2/c1-8(2)5-11-10(4)13(14-7-15)9(3)6-12(11)16/h6-7,16H,1,5H2,2-4H3,(H,14,15) |
| InChIKey | YNOHUAPXUCRUSX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|