C15H22 — CID 144794742
1-ethyl-3,4,5-trimethyl-2-(2-methylprop-2-enyl)benzene (PubChem CID 144794742) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-ethyl-3,4,5-trimethyl-2-(2-methylprop-2-enyl)benzene.
| Compound Name | 1-ethyl-3,4,5-trimethyl-2-(2-methylprop-2-enyl)benzene |
|---|---|
| PubChem CID | 144794742 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-ethyl-3,4,5-trimethyl-2-(2-methylprop-2-enyl)benzene |
| SMILES | C=C(C)Cc1c(CC)cc(C)c(C)c1C |
| InChI | InChI=1S/C15H22/c1-7-14-9-11(4)12(5)13(6)15(14)8-10(2)3/h9H,2,7-8H2,1,3-6H3 |
| InChIKey | ICFSFIFBWZSNNS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|