C11H18O5 — CID 10799464
(3a,7,7-trimethyl-4,5,6,7a-tetrahydrobenzotrioxol-4-yl) acetate (PubChem CID 10799464) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3a,7,7-trimethyl-4,5,6,7a-tetrahydrobenzotrioxol-4-yl) acetate.
| Compound Name | (3a,7,7-trimethyl-4,5,6,7a-tetrahydrobenzotrioxol-4-yl) acetate |
|---|---|
| PubChem CID | 10799464 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3a,7,7-trimethyl-4,5,6,7a-tetrahydrobenzotrioxol-4-yl) acetate |
| SMILES | CC(=O)OC1CCC(C)(C)C2OOOC12C |
| InChI | InChI=1S/C11H18O5/c1-7(12)13-8-5-6-10(2,3)9-11(8,4)15-16-14-9/h8-9H,5-6H2,1-4H3 |
| InChIKey | GYMXAKLFMBDULJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|