C15H9Cl2FN2S — CID 107995024
2-(4-chloro-3-fluorophenyl)-5-[chloro(phenyl)methyl]-1,3,4-thiadiazole (PubChem CID 107995024) has the molecular formula C15H9Cl2FN2S and a molecular weight of 339.22 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-5-[chloro(phenyl)methyl]-1,3,4-thiadiazole.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-5-[chloro(phenyl)methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 107995024 |
| Molecular Formula | C15H9Cl2FN2S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-5-[chloro(phenyl)methyl]-1,3,4-thiadiazole |
| SMILES | Fc1cc(-c2nnc(C(Cl)c3ccccc3)s2)ccc1Cl |
| InChI | InChI=1S/C15H9Cl2FN2S/c16-11-7-6-10(8-12(11)18)14-19-20-15(21-14)13(17)9-4-2-1-3-5-9/h1-8,13H |
| InChIKey | RVHFMWABTUPBHU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|