C14H15NO2S — CID 10801393
(1S,2S,2'S)-2'-ethenyl-2',4-dimethyl-1-oxospiro[1λ4,4-benzothiazine-2,1'-cyclopropane]-3-one (PubChem CID 10801393) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is (1S,2S,2'S)-2'-ethenyl-2',4-dimethyl-1-oxospiro[1λ4,4-benzothiazine-2,1'-cyclopropane]-3-one.
| Compound Name | (1S,2S,2'S)-2'-ethenyl-2',4-dimethyl-1-oxospiro[1λ4,4-benzothiazine-2,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 10801393 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (1S,2S,2'S)-2'-ethenyl-2',4-dimethyl-1-oxospiro[1λ4,4-benzothiazine-2,1'-cyclopropane]-3-one |
| SMILES | C=C[C@]1(C)C[C@@]12C(=O)N(C)c1ccccc1[S@@]2=O |
| InChI | InChI=1S/C14H15NO2S/c1-4-13(2)9-14(13)12(16)15(3)10-7-5-6-8-11(10)18(14)17/h4-8H,1,9H2,2-3H3/t13-,14-,18+/m1/s1 |
| InChIKey | TVBDZNSHXUMEFR-LBTNJELSSA-N |
| XLogP | 2.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|