C26H20IN3O3 — CID 1080185
N-[(E)-1-(1-acetylindol-3-yl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 1080185) has the molecular formula C26H20IN3O3 and a molecular weight of 549.37 g/mol. Its IUPAC name is N-[(E)-1-(1-acetylindol-3-yl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1-acetylindol-3-yl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 1080185 |
| Molecular Formula | C26H20IN3O3 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | N-[(E)-1-(1-acetylindol-3-yl)-3-(4-iodoanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)n1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2ccc(I)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H20IN3O3/c1-17(31)30-16-19(22-9-5-6-10-24(22)30)15-23(29-25(32)18-7-3-2-4-8-18)26(33)28-21-13-11-20(27)12-14-21/h2-16H,1H3,(H,28,33)(H,29,32)/b23-15+ |
| InChIKey | QDUFKWVTASCGHH-HZHRSRAPSA-N |
| XLogP | 5.32 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|