C15H13NO4 — CID 10802052
3-(2-hydroxyethyl)-4-methyl-6H-pyrano[3,2-c]quinoline-2,5-dione (PubChem CID 10802052) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-4-methyl-6H-pyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 3-(2-hydroxyethyl)-4-methyl-6H-pyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 10802052 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(2-hydroxyethyl)-4-methyl-6H-pyrano[3,2-c]quinoline-2,5-dione |
| SMILES | Cc1c(CCO)c(=O)oc2c1c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H13NO4/c1-8-9(6-7-17)15(19)20-13-10-4-2-3-5-11(10)16-14(18)12(8)13/h2-5,17H,6-7H2,1H3,(H,16,18) |
| InChIKey | FTZCIPUBLAGIMH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|