C23H20N2O7 — CID 137316048
ethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2-imino-5-oxo-6H-pyrano[3,2-c]quinoline-3-carboxylate (PubChem CID 137316048) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is ethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2-imino-5-oxo-6H-pyrano[3,2-c]quinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2-imino-5-oxo-6H-pyrano[3,2-c]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 137316048 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | ethyl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2-imino-5-oxo-6H-pyrano[3,2-c]quinoline-3-carboxylate |
| SMILES | [H]/N=c1\oc2c(c(-c3cc(OC)c(O)c(OC)c3)c1C(=O)OCC)c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C23H20N2O7/c1-4-31-23(28)18-16(11-9-14(29-2)19(26)15(10-11)30-3)17-20(32-21(18)24)12-7-5-6-8-13(12)25-22(17)27/h5-10,24,26H,4H2,1-3H3,(H,25,27)/b24-21- |
| InChIKey | POUZGAQPBCVAJV-FLFQWRMESA-N |
| XLogP | 3.32 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|