C16H18O2S — CID 10802297
2-(benzylsulfanylmethylidene)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 10802297) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is 2-(benzylsulfanylmethylidene)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(benzylsulfanylmethylidene)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 10802297 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(benzylsulfanylmethylidene)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(=CSCc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C16H18O2S/c1-16(2)8-14(17)13(15(18)9-16)11-19-10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | NWEHZGOVSJKKDT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|