C18H20ClNO — CID 69040452
2-benzyl-7,7-dimethyl-6,8-dihydroquinolin-5-one;hydrochloride (PubChem CID 69040452) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-benzyl-7,7-dimethyl-6,8-dihydroquinolin-5-one;hydrochloride.
| Compound Name | 2-benzyl-7,7-dimethyl-6,8-dihydroquinolin-5-one;hydrochloride |
|---|---|
| PubChem CID | 69040452 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-benzyl-7,7-dimethyl-6,8-dihydroquinolin-5-one;hydrochloride |
| SMILES | CC1(C)CC(=O)c2ccc(Cc3ccccc3)nc2C1.Cl |
| InChI | InChI=1S/C18H19NO.ClH/c1-18(2)11-16-15(17(20)12-18)9-8-14(19-16)10-13-6-4-3-5-7-13;/h3-9H,10-12H2,1-2H3;1H |
| InChIKey | HKXLVHMCQUNBTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |