C21H26N2 — CID 10804615
N-[(3S)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]cyclohexanimine (PubChem CID 10804615) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[(3S)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]cyclohexanimine.
| Compound Name | N-[(3S)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]cyclohexanimine |
|---|---|
| PubChem CID | 10804615 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[(3S)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]cyclohexanimine |
| SMILES | c1ccc2cc(CN3CC[C@H](N=C4CCCCC4)C3)ccc2c1 |
| InChI | InChI=1S/C21H26N2/c1-2-8-20(9-3-1)22-21-12-13-23(16-21)15-17-10-11-18-6-4-5-7-19(18)14-17/h4-7,10-11,14,21H,1-3,8-9,12-13,15-16H2/t21-/m0/s1 |
| InChIKey | PJUMFEPIGFZNBI-NRFANRHFSA-N |
| XLogP | 4.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|