C20H19BrN2OS — CID 171352035
5-bromo-N-[(3R)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 171352035) has the molecular formula C20H19BrN2OS and a molecular weight of 415.36 g/mol. Its IUPAC name is 5-bromo-N-[(3R)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(3R)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 171352035 |
| Molecular Formula | C20H19BrN2OS |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 5-bromo-N-[(3R)-1-(naphthalen-2-ylmethyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(Cc2ccc3ccccc3c2)C1)c1ccc(Br)s1 |
| InChI | InChI=1S/C20H19BrN2OS/c21-19-8-7-18(25-19)20(24)22-17-9-10-23(13-17)12-14-5-6-15-3-1-2-4-16(15)11-14/h1-8,11,17H,9-10,12-13H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | KUPNFPMWPOCEBU-QGZVFWFLSA-N |
| XLogP | 4.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |