C17H36O3Si — CID 10805397
(Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyundec-5-ene-1,2-diol (PubChem CID 10805397) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyundec-5-ene-1,2-diol.
| Compound Name | (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyundec-5-ene-1,2-diol |
|---|---|
| PubChem CID | 10805397 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyundec-5-ene-1,2-diol |
| SMILES | CCCCC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C17H36O3Si/c1-7-8-9-10-11-12-13-16(15(19)14-18)20-21(5,6)17(2,3)4/h11-12,15-16,18-19H,7-10,13-14H2,1-6H3/b12-11-/t15-,16+/m1/s1 |
| InChIKey | YIXAHBYHMNNSDC-WXJRXKGESA-N |
| XLogP | 4.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|