C16H15N3O3S — CID 10806239
N'-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)oxamide (PubChem CID 10806239) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N'-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 10806239 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N'-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)oxamide |
| SMILES | Cc1cc2nc(NC(=O)C(=O)NCc3ccco3)sc2cc1C |
| InChI | InChI=1S/C16H15N3O3S/c1-9-6-12-13(7-10(9)2)23-16(18-12)19-15(21)14(20)17-8-11-4-3-5-22-11/h3-7H,8H2,1-2H3,(H,17,20)(H,18,19,21) |
| InChIKey | UCWAFPGWKLACIO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|