C16H13N3O3 — CID 10708979
N-(furan-2-ylmethyl)-N'-quinolin-3-yloxamide (PubChem CID 10708979) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-quinolin-3-yloxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-quinolin-3-yloxamide |
|---|---|
| PubChem CID | 10708979 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-quinolin-3-yloxamide |
| SMILES | O=C(NCc1ccco1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H13N3O3/c20-15(18-10-13-5-3-7-22-13)16(21)19-12-8-11-4-1-2-6-14(11)17-9-12/h1-9H,10H2,(H,18,20)(H,19,21) |
| InChIKey | AFBZLAIGJXMEPV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|