C18H23NO5 — CID 10806548
[(1R,2R,3S)-2-acetamido-3-(4-methoxyphenyl)-5-oxocyclohexyl]methyl acetate (PubChem CID 10806548) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(1R,2R,3S)-2-acetamido-3-(4-methoxyphenyl)-5-oxocyclohexyl]methyl acetate.
| Compound Name | [(1R,2R,3S)-2-acetamido-3-(4-methoxyphenyl)-5-oxocyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 10806548 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(1R,2R,3S)-2-acetamido-3-(4-methoxyphenyl)-5-oxocyclohexyl]methyl acetate |
| SMILES | COc1ccc([C@@H]2CC(=O)C[C@@H](COC(C)=O)[C@@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-11(20)19-18-14(10-24-12(2)21)8-15(22)9-17(18)13-4-6-16(23-3)7-5-13/h4-7,14,17-18H,8-10H2,1-3H3,(H,19,20)/t14-,17-,18-/m0/s1 |
| InChIKey | COUMIHARQRIJRW-WBAXXEDZSA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |