C20H18O6 — CID 10808026
(2R)-2-[(2R)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]-2-phenylmethoxyacetic acid (PubChem CID 10808026) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2R)-2-[(2R)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]-2-phenylmethoxyacetic acid.
| Compound Name | (2R)-2-[(2R)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]-2-phenylmethoxyacetic acid |
|---|---|
| PubChem CID | 10808026 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2R)-2-[(2R)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]-2-phenylmethoxyacetic acid |
| SMILES | O=C1O[C@@H]([C@@H](OCc2ccccc2)C(=O)O)C=C1OCc1ccccc1 |
| InChI | InChI=1S/C20H18O6/c21-19(22)18(25-13-15-9-5-2-6-10-15)16-11-17(20(23)26-16)24-12-14-7-3-1-4-8-14/h1-11,16,18H,12-13H2,(H,21,22)/t16-,18-/m1/s1 |
| InChIKey | JQLTUKBEDPOITK-SJLPKXTDSA-N |
| XLogP | 2.68 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |