C18H23NO8 — CID 23260033
N-[(1S,2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(2S)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]pentyl]acetamide (PubChem CID 23260033) has the molecular formula C18H23NO8 and a molecular weight of 381.38 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(2S)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]pentyl]acetamide.
| Compound Name | N-[(1S,2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(2S)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 23260033 |
| Molecular Formula | C18H23NO8 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[(1S,2R,3S,4R)-2,3,4,5-tetrahydroxy-1-[(2S)-5-oxo-4-phenylmethoxy-2H-furan-2-yl]pentyl]acetamide |
| SMILES | CC(=O)N[C@@H]([C@@H](O)[C@H](O)[C@H](O)CO)[C@@H]1C=C(OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H23NO8/c1-10(21)19-15(17(24)16(23)12(22)8-20)13-7-14(18(25)27-13)26-9-11-5-3-2-4-6-11/h2-7,12-13,15-17,20,22-24H,8-9H2,1H3,(H,19,21)/t12-,13+,15-,16-,17-/m1/s1 |
| InChIKey | YAUVCJVMXAAOED-IMPMIVQMSA-N |
| XLogP | -1.41 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |