C20H26O6 — CID 10808625
[4-[(1S,6R,9S,12S)-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]phenyl]methyl acetate (PubChem CID 10808625) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [4-[(1S,6R,9S,12S)-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]phenyl]methyl acetate.
| Compound Name | [4-[(1S,6R,9S,12S)-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 10808625 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [4-[(1S,6R,9S,12S)-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]phenyl]methyl acetate |
| SMILES | CO[C@H]1O[C@@]2(c3ccc(COC(C)=O)cc3)CC[C@H]3CCCC[C@]31OO2 |
| InChI | InChI=1S/C20H26O6/c1-14(21)23-13-15-6-8-17(9-7-15)20-12-10-16-5-3-4-11-19(16,25-26-20)18(22-2)24-20/h6-9,16,18H,3-5,10-13H2,1-2H3/t16-,18+,19+,20+/m1/s1 |
| InChIKey | FGFMXJTULHPRPY-GTAWCEEGSA-N |
| XLogP | 3.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|