C24H26O6 — CID 10070131
4-[(1S,6R,9R,12R)-12-phenylmethoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]benzoic acid (PubChem CID 10070131) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[(1S,6R,9R,12R)-12-phenylmethoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]benzoic acid.
| Compound Name | 4-[(1S,6R,9R,12R)-12-phenylmethoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]benzoic acid |
|---|---|
| PubChem CID | 10070131 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[(1S,6R,9R,12R)-12-phenylmethoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@@]23CC[C@H]4CCCC[C@@]4(OO2)[C@H](OCc2ccccc2)O3)cc1 |
| InChI | InChI=1S/C24H26O6/c25-21(26)18-9-11-20(12-10-18)24-15-13-19-8-4-5-14-23(19,29-30-24)22(28-24)27-16-17-6-2-1-3-7-17/h1-3,6-7,9-12,19,22H,4-5,8,13-16H2,(H,25,26)/t19-,22-,23+,24-/m1/s1 |
| InChIKey | SPZTXCRRQUWGEJ-OUJCMCIWSA-N |
| XLogP | 4.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|