C17H22Cl2O3S — CID 10809587
methyl 4-[6-(2,6-dichlorophenyl)hexylsulfanyl]-3-oxobutanoate (PubChem CID 10809587) has the molecular formula C17H22Cl2O3S and a molecular weight of 377.33 g/mol. Its IUPAC name is methyl 4-[6-(2,6-dichlorophenyl)hexylsulfanyl]-3-oxobutanoate.
| Compound Name | methyl 4-[6-(2,6-dichlorophenyl)hexylsulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 10809587 |
| Molecular Formula | C17H22Cl2O3S |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | methyl 4-[6-(2,6-dichlorophenyl)hexylsulfanyl]-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CSCCCCCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H22Cl2O3S/c1-22-17(21)11-13(20)12-23-10-5-3-2-4-7-14-15(18)8-6-9-16(14)19/h6,8-9H,2-5,7,10-12H2,1H3 |
| InChIKey | CZEPDZCBQOEKJL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|