C19H38O4Si2 — CID 10810215
(1S,2S,3R,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]heptane-3-carbaldehyde (PubChem CID 10810215) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is (1S,2S,3R,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]heptane-3-carbaldehyde.
| Compound Name | (1S,2S,3R,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]heptane-3-carbaldehyde |
|---|---|
| PubChem CID | 10810215 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (1S,2S,3R,5R,6R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]heptane-3-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C19H38O4Si2/c1-18(2,3)24(7,8)22-14-11-13(12-20)15(17-16(14)21-17)23-25(9,10)19(4,5)6/h12-17H,11H2,1-10H3/t13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | JGYYYEPCTLSJBZ-BQJWPVKWSA-N |
| XLogP | 4.75 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|