C21H42O5Si2 — CID 10002818
methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]heptan-2-yl]acetate (PubChem CID 10002818) has the molecular formula C21H42O5Si2 and a molecular weight of 430.73 g/mol. Its IUPAC name is methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]heptan-2-yl]acetate.
| Compound Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 10002818 |
| Molecular Formula | C21H42O5Si2 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C21H42O5Si2/c1-20(2,3)27(8,9)25-15-13-12-14(16-18(15)24-16)17(19(22)23-7)26-28(10,11)21(4,5)6/h14-18H,12-13H2,1-11H3/t14-,15+,16-,17-,18+/m1/s1 |
| InChIKey | WDEMLEBNMHEFBT-ILOCAZANSA-N |
| XLogP | 5.12 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|