C23H35NO4Si — CID 10811914
(2S)-2-benzyl-1-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoyl]-3-methoxy-2H-pyrrol-5-one (PubChem CID 10811914) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is (2S)-2-benzyl-1-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoyl]-3-methoxy-2H-pyrrol-5-one.
| Compound Name | (2S)-2-benzyl-1-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoyl]-3-methoxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 10811914 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2S)-2-benzyl-1-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methylbutanoyl]-3-methoxy-2H-pyrrol-5-one |
| SMILES | COC1=CC(=O)N(C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO4Si/c1-16(2)21(28-29(7,8)23(3,4)5)22(26)24-18(19(27-6)15-20(24)25)14-17-12-10-9-11-13-17/h9-13,15-16,18,21H,14H2,1-8H3/t18-,21-/m0/s1 |
| InChIKey | GNTPZRFNDUJEIT-RXVVDRJESA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|