C20H27F3O4S — CID 10812076
(2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-propan-2-yloxyhepta-3,4-dien-3-yl)sulfonylbenzene (PubChem CID 10812076) has the molecular formula C20H27F3O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-propan-2-yloxyhepta-3,4-dien-3-yl)sulfonylbenzene.
| Compound Name | (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-propan-2-yloxyhepta-3,4-dien-3-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 10812076 |
| Molecular Formula | C20H27F3O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2-ethoxy-1,1,1-trifluoro-6,6-dimethyl-2-propan-2-yloxyhepta-3,4-dien-3-yl)sulfonylbenzene |
| SMILES | CCOC(OC(C)C)(C(=C=CC(C)(C)C)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3O4S/c1-7-26-19(20(21,22)23,27-15(2)3)17(13-14-18(4,5)6)28(24,25)16-11-9-8-10-12-16/h8-12,14-15H,7H2,1-6H3 |
| InChIKey | CIQGLUHZFFKJCG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|