C24H28N2O5 — CID 10812255
5,7-dimethyl-1-[(2,3,4-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid (PubChem CID 10812255) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5,7-dimethyl-1-[(2,3,4-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid.
| Compound Name | 5,7-dimethyl-1-[(2,3,4-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 10812255 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5,7-dimethyl-1-[(2,3,4-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
| SMILES | COc1ccc(CC2(C(=O)O)NCCc3c2[nH]c2cc(C)cc(C)c32)c(OC)c1OC |
| InChI | InChI=1S/C24H28N2O5/c1-13-10-14(2)19-16-8-9-25-24(23(27)28,22(16)26-17(19)11-13)12-15-6-7-18(29-3)21(31-5)20(15)30-4/h6-7,10-11,25-26H,8-9,12H2,1-5H3,(H,27,28) |
| InChIKey | NMMNWFAJRGAAPI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |