C24H48O4Si — CID 10812479
[(2R,3S,4R)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate (PubChem CID 10812479) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is [(2R,3S,4R)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10812479 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | [(2R,3S,4R)-5-hydroxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(O)[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si/c1-13-14-21(25)20(9)22(19(8)15-27-23(26)24(10,11)12)28-29(16(2)3,17(4)5)18(6)7/h13,16-22,25H,1,14-15H2,2-12H3/t19-,20-,21?,22+/m1/s1 |
| InChIKey | DGHVFRDZOOLFJN-ZTTSMYDPSA-N |
| XLogP | 6.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|