C26H37NO5Si — CID 10814277
[2-[di(propan-2-yl)carbamoyl]-4-hydroxy-6-trimethylsilylphenyl] (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoate (PubChem CID 10814277) has the molecular formula C26H37NO5Si and a molecular weight of 471.67 g/mol. Its IUPAC name is [2-[di(propan-2-yl)carbamoyl]-4-hydroxy-6-trimethylsilylphenyl] (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoate.
| Compound Name | [2-[di(propan-2-yl)carbamoyl]-4-hydroxy-6-trimethylsilylphenyl] (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 10814277 |
| Molecular Formula | C26H37NO5Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [2-[di(propan-2-yl)carbamoyl]-4-hydroxy-6-trimethylsilylphenyl] (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoate |
| SMILES | CC(C)N(C(=O)c1cc(O)cc([Si](C)(C)C)c1OC(=O)[C@@H](C)[C@H](O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C26H37NO5Si/c1-16(2)27(17(3)4)25(30)21-14-20(28)15-22(33(6,7)8)24(21)32-26(31)18(5)23(29)19-12-10-9-11-13-19/h9-18,23,28-29H,1-8H3/t18-,23-/m0/s1 |
| InChIKey | NQCRDEZDPBCYQT-MBSDFSHPSA-N |
| XLogP | 4.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|