About 1,1-dihydroperoxypentane
1,1-dihydroperoxypentane (PubChem CID 10820579) has the molecular formula C5H12O4
and a molecular weight of 136.15 g/mol. Its IUPAC name is 1,1-dihydroperoxypentane.
Molecular Properties
| Compound Name | 1,1-dihydroperoxypentane |
| PubChem CID | 10820579 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1,1-dihydroperoxypentane |
| SMILES | CCCCC(OO)OO |
| InChI | InChI=1S/C5H12O4/c1-2-3-4-5(8-6)9-7/h5-7H,2-4H2,1H3 |
| InChIKey | LAKAXNCTLYGLOQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dihydroperoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dihydroperoxypentane?
The IUPAC name of 1,1-dihydroperoxypentane (CID 10820579) is 1,1-dihydroperoxypentane.
What is the SMILES notation for 1,1-dihydroperoxypentane?
The canonical SMILES for 1,1-dihydroperoxypentane is CCCCC(OO)OO.
What is the InChIKey of 1,1-dihydroperoxypentane?
The InChIKey is LAKAXNCTLYGLOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O4/c1-2-3-4-5(8-6)9-7/h5-7H,2-4H2,1H3.
What are the key properties of 1,1-dihydroperoxypentane?
1,1-dihydroperoxypentane has a molecular weight of 136.15 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dihydroperoxypentane is sourced from PubChem (CID 10820579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).