(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid

C8H14N4O3 — CID 10822509

IUPAC(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid
SMILES[N-]=[N+]=N[C@H](CC/C=C\[C@@H](N)CO)C(=O)O
InChIInChI=1S/C8H14N4O3/c9-6(5-13)3-1-2-4-7(8(14)15)11-12-10/h1,3,6-7,13H,2,4-5,9H2,(H,14,15)/b3-1-/t6-,7-/m1/s1
InChIKeyIMTIUQWMFFEGGP-BTIMCXLTSA-N
MW214.23 g/mol
LogP0.41
Rot. Bonds7

About (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid

(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid (PubChem CID 10822509) has the molecular formula C8H14N4O3 and a molecular weight of 214.23 g/mol. Its IUPAC name is (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid.

Molecular Properties

Compound Name(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid
PubChem CID10822509
Molecular FormulaC8H14N4O3
Molecular Weight214.23 g/mol
Exact Mass214.11
IUPAC Name(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid
SMILES[N-]=[N+]=N[C@H](CC/C=C\[C@@H](N)CO)C(=O)O
InChIInChI=1S/C8H14N4O3/c9-6(5-13)3-1-2-4-7(8(14)15)11-12-10/h1,3,6-7,13H,2,4-5,9H2,(H,14,15)/b3-1-/t6-,7-/m1/s1
InChIKeyIMTIUQWMFFEGGP-BTIMCXLTSA-N
XLogP0.41
TPSA132.31 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.23
LogP ≤ 50.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-azido-3-hydroxypropanoic acid
CID 54415353
(2S)-2-azidoheptanoic acid
CID 122577491
2-azidopent-4-enoic acid
CID 77132005
(2R)-2-azido-6-bromohexanoic acid
CID 11064392
(2S)-2,6-diazidohexanoic acid
CID 101430733
2-azido-7-ethoxy-7-oxoheptanoic acid
CID 139368374
(2S)-2-azido-7-bromoheptanoic acid
CID 11010362
2-azido-3,4-dihydroxybutanoic acid
CID 122531609
(2R)-2,6-diamino-3-azidohexanoic acid
CID 140570098
(2S)-2-amino-3-azidobutanoic acid
CID 140958168
2-azido-5-(1,3-dioxoisoindol-2-yl)pentanoic acid
CID 139702305
(2S)-2-azido-3-(4-fluorophenyl)propanoic acid
CID 59552594

Frequently Asked Questions

What is the IUPAC name of (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid?
The IUPAC name of (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid (CID 10822509) is (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid.
What is the SMILES notation for (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid?
The canonical SMILES for (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid is [N-]=[N+]=N[C@H](CC/C=C\[C@@H](N)CO)C(=O)O.
What is the InChIKey of (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid?
The InChIKey is IMTIUQWMFFEGGP-BTIMCXLTSA-N. The full InChI is InChI=1S/C8H14N4O3/c9-6(5-13)3-1-2-4-7(8(14)15)11-12-10/h1,3,6-7,13H,2,4-5,9H2,(H,14,15)/b3-1-/t6-,7-/m1/s1.
What are the key properties of (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid?
(Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid has a molecular weight of 214.23 g/mol, XLogP of 0.41, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2R,7R)-7-amino-2-azido-8-hydroxyoct-5-enoic acid is sourced from PubChem (CID 10822509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).