C12H12OS2 — CID 10823752
6-benzyl-2,3-dihydro-1,4-dithiine-5-carbaldehyde (PubChem CID 10823752) has the molecular formula C12H12OS2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 6-benzyl-2,3-dihydro-1,4-dithiine-5-carbaldehyde.
| Compound Name | 6-benzyl-2,3-dihydro-1,4-dithiine-5-carbaldehyde |
|---|---|
| PubChem CID | 10823752 |
| Molecular Formula | C12H12OS2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 6-benzyl-2,3-dihydro-1,4-dithiine-5-carbaldehyde |
| SMILES | O=CC1=C(Cc2ccccc2)SCCS1 |
| InChI | InChI=1S/C12H12OS2/c13-9-12-11(14-6-7-15-12)8-10-4-2-1-3-5-10/h1-5,9H,6-8H2 |
| InChIKey | JFMSMSUZMGULDR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|