C12H9NO5S — CID 10826510
2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)oxy]isoindole-1,3-dione (PubChem CID 10826510) has the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)oxy]isoindole-1,3-dione.
| Compound Name | 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)oxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10826510 |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)oxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H9NO5S/c14-11-9-3-1-2-4-10(9)12(15)13(11)18-8-5-6-19(16,17)7-8/h1-6,8H,7H2 |
| InChIKey | XREFFVUZINOMRA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|