C14H13NO3 — CID 11230315
2-(2,3-dideuteriocyclohex-2-en-1-yl)oxyisoindole-1,3-dione (PubChem CID 11230315) has the molecular formula C14H13NO3 and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-(2,3-dideuteriocyclohex-2-en-1-yl)oxyisoindole-1,3-dione.
| Compound Name | 2-(2,3-dideuteriocyclohex-2-en-1-yl)oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11230315 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-(2,3-dideuteriocyclohex-2-en-1-yl)oxyisoindole-1,3-dione |
| SMILES | [2H]C1=C([2H])C(ON2C(=O)c3ccccc3C2=O)CCC1 |
| InChI | InChI=1S/C14H13NO3/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h2,4-6,8-10H,1,3,7H2/i2D,6D |
| InChIKey | QXFTXVXMRKJENL-ZJTJSSCZSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|