C15H24O5 — CID 10826913
(3'aR,4S,7'aR)-2,2,2',2',5,5-hexamethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one (PubChem CID 10826913) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (3'aR,4S,7'aR)-2,2,2',2',5,5-hexamethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one.
| Compound Name | (3'aR,4S,7'aR)-2,2,2',2',5,5-hexamethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
|---|---|
| PubChem CID | 10826913 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (3'aR,4S,7'aR)-2,2,2',2',5,5-hexamethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
| SMILES | CC1(C)O[C@@H]2CC[C@@]3(OC(C)(C)OC3(C)C)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H24O5/c1-12(2)15(20-14(5,6)19-12)8-7-9-10(11(15)16)18-13(3,4)17-9/h9-10H,7-8H2,1-6H3/t9-,10-,15-/m1/s1 |
| InChIKey | BZTUTQVXELDGCM-IQMDTDKHSA-N |
| XLogP | 2.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |