C16H26O5 — CID 134864306
(3aR,6S,7aR)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,3a-trimethyl-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one (PubChem CID 134864306) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3aR,6S,7aR)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,3a-trimethyl-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one.
| Compound Name | (3aR,6S,7aR)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,3a-trimethyl-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 134864306 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3aR,6S,7aR)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,3a-trimethyl-5,6,7,7a-tetrahydro-1,3-benzodioxol-4-one |
| SMILES | CC1(C)OCC([C@@H]2CC(=O)[C@]3(C)OC(C)(C)O[C@@H]3C2)CO1 |
| InChI | InChI=1S/C16H26O5/c1-14(2)18-8-11(9-19-14)10-6-12(17)16(5)13(7-10)20-15(3,4)21-16/h10-11,13H,6-9H2,1-5H3/t10-,13-,16+/m1/s1 |
| InChIKey | IKWUSTPFOGZDPK-ZXIHIIQKSA-N |
| XLogP | 2.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |