C12H20O4 — CID 11218437
(3aR,5R,6R,7R,7aR)-6-methoxy-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one (PubChem CID 11218437) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3aR,5R,6R,7R,7aR)-6-methoxy-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aR,5R,6R,7R,7aR)-6-methoxy-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 11218437 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3aR,5R,6R,7R,7aR)-6-methoxy-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CO[C@@H]1[C@@H](C)[C@H]2OC(C)(C)O[C@H]2C(=O)[C@@H]1C |
| InChI | InChI=1S/C12H20O4/c1-6-8(13)11-10(7(2)9(6)14-5)15-12(3,4)16-11/h6-7,9-11H,1-5H3/t6-,7+,9-,10+,11-/m0/s1 |
| InChIKey | MGIQFQXTQLSXEY-WJOISOPKSA-N |
| XLogP | 1.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |