C16H26O6 — CID 10852749
(1R,3R,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one (PubChem CID 10852749) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1R,3R,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one.
| Compound Name | (1R,3R,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
|---|---|
| PubChem CID | 10852749 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1R,3R,7R,9R)-7-(2-methoxypropan-2-yl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
| SMILES | COC(C)(C)[C@@]12C[C@H]3OC(C)(C)O[C@H]3C(=O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C16H26O6/c1-13(2,18-7)16-8-9-11(20-14(3,4)19-9)10(17)12(16)21-15(5,6)22-16/h9,11-12H,8H2,1-7H3/t9-,11-,12+,16-/m1/s1 |
| InChIKey | DOPLOPOENAMQNC-JGLBJEFFSA-N |
| XLogP | 1.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |