C18H24O7 — CID 134943612
(1S,5R,9S,12S,15S,19S)-3,3,9-trimethyl-2,4,10,14-tetraoxatetracyclo[10.6.1.01,5.015,19]nonadecane-11,13,18-trione (PubChem CID 134943612) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is (1S,5R,9S,12S,15S,19S)-3,3,9-trimethyl-2,4,10,14-tetraoxatetracyclo[10.6.1.01,5.015,19]nonadecane-11,13,18-trione.
| Compound Name | (1S,5R,9S,12S,15S,19S)-3,3,9-trimethyl-2,4,10,14-tetraoxatetracyclo[10.6.1.01,5.015,19]nonadecane-11,13,18-trione |
|---|---|
| PubChem CID | 134943612 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (1S,5R,9S,12S,15S,19S)-3,3,9-trimethyl-2,4,10,14-tetraoxatetracyclo[10.6.1.01,5.015,19]nonadecane-11,13,18-trione |
| SMILES | C[C@H]1CCC[C@H]2OC(C)(C)O[C@]23C(=O)CC[C@@H]2OC(=O)[C@H](C(=O)O1)[C@@H]23 |
| InChI | InChI=1S/C18H24O7/c1-9-5-4-6-12-18(25-17(2,3)24-12)11(19)8-7-10-14(18)13(15(20)22-9)16(21)23-10/h9-10,12-14H,4-8H2,1-3H3/t9-,10-,12+,13-,14+,18+/m0/s1 |
| InChIKey | PBYVJISQFJQTNL-YLJKGRNTSA-N |
| XLogP | 1.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|