C12H17ClN4S — CID 10826971
1-(N'-butylcarbamimidoyl)-3-(4-chlorophenyl)thiourea (PubChem CID 10826971) has the molecular formula C12H17ClN4S and a molecular weight of 284.82 g/mol. Its IUPAC name is 1-(N'-butylcarbamimidoyl)-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-(N'-butylcarbamimidoyl)-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 10826971 |
| Molecular Formula | C12H17ClN4S |
| Molecular Weight | 284.82 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-(N'-butylcarbamimidoyl)-3-(4-chlorophenyl)thiourea |
| SMILES | CCCC/N=C(\N)NC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN4S/c1-2-3-8-15-11(14)17-12(18)16-10-6-4-9(13)5-7-10/h4-7H,2-3,8H2,1H3,(H4,14,15,16,17,18) |
| InChIKey | QIWODQJGDRTFSE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|