C16H19F3N2O — CID 10828898
5-[3-[3-[4-(trifluoromethyl)phenyl]propoxy]propyl]-1H-imidazole (PubChem CID 10828898) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-[3-[3-[4-(trifluoromethyl)phenyl]propoxy]propyl]-1H-imidazole.
| Compound Name | 5-[3-[3-[4-(trifluoromethyl)phenyl]propoxy]propyl]-1H-imidazole |
|---|---|
| PubChem CID | 10828898 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-[3-[3-[4-(trifluoromethyl)phenyl]propoxy]propyl]-1H-imidazole |
| SMILES | FC(F)(F)c1ccc(CCCOCCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C16H19F3N2O/c17-16(18,19)14-7-5-13(6-8-14)3-1-9-22-10-2-4-15-11-20-12-21-15/h5-8,11-12H,1-4,9-10H2,(H,20,21) |
| InChIKey | GGHGINUQTYSNFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|