C15H17F3N4O2 — CID 23219067
1-[3-(1H-imidazol-5-yl)propoxy]-1-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 23219067) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propoxy]-1-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propoxy]-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 23219067 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propoxy]-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | NC(=O)N(Cc1ccc(C(F)(F)F)cc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C15H17F3N4O2/c16-15(17,18)12-5-3-11(4-6-12)9-22(14(19)23)24-7-1-2-13-8-20-10-21-13/h3-6,8,10H,1-2,7,9H2,(H2,19,23)(H,20,21) |
| InChIKey | HBFKRBZHWSYIGW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|